62298-42-4 Usage
General Description
AZURE B EOSINATE PRACTICAL GRADE is a mixed dye essentially used in laboratories for pathological studies. The two components, Azure B and Eosin, play different roles in staining procedures, with Azure B being a basic dye that colors acid structures blue, and Eosin acting as an acidic dye that colors basic structures red. This makes it a strong histological stain for highlighting different elements in biological tissues. The product is generally found in powder or crystalline form. Its handling requires care, as it may pose some health risks, and should be done in accordance with guidelines for lab-grade chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 62298-42-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,2,2,9 and 8 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 62298-42:
(7*6)+(6*2)+(5*2)+(4*9)+(3*8)+(2*4)+(1*2)=134
134 % 10 = 4
So 62298-42-4 is a valid CAS Registry Number.
InChI:InChI=1/C20H8Br4O5.2C15H15N3S/c21-11-5-9-17(13(23)15(11)25)28-18-10(6-12(22)16(26)14(18)24)20(9)8-4-2-1-3-7(8)19(27)29-20;2*1-16-10-4-6-12-14(8-10)19-15-9-11(18(2)3)5-7-13(15)17-12/h1-6,25-26H;2*4-9H,1-3H3