622-64-0 Usage
General Description
Hordenine sulfate is a naturally occurring alkaloid found in various plants, such as barley grass and bitter orange. It is known for its stimulant and cognitive enhancing properties, making it popular in dietary supplements and nootropic products. Hordenine sulfate is believed to work by increasing the release of dopamine and norepinephrine in the brain, leading to improved mood, focus, and energy levels. Additionally, it may also have potential fat-burning and metabolism-boosting effects, though more research is needed to confirm these benefits. Overall, hordenine sulfate is often used as an ingredient in pre-workout supplements and weight management products due to its stimulating and performance-enhancing properties.
Check Digit Verification of cas no
The CAS Registry Mumber 622-64-0 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,2 and 2 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 622-64:
(5*6)+(4*2)+(3*2)+(2*6)+(1*4)=60
60 % 10 = 0
So 622-64-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H15NO.H2O4S/c1-11(2)8-7-9-3-5-10(12)6-4-9;1-5(2,3)4/h3-6,12H,7-8H2,1-2H3;(H2,1,2,3,4)
