58920-79-9 Usage
Description
Methyl 1-cyanocyclobutanecarboxylate is a carboxylate derivative, characterized by the presence of a cyano group and a cyclobutane ring. It is an organic compound that offers a range of chemical properties, making it a versatile reagent in various chemical reactions and processes.
Uses
Used in Organic Synthesis:
Methyl 1-cyanocyclobutanecarboxylate is used as an organic reagent for the synthesis of various organic compounds. Its unique structure allows it to participate in a wide range of chemical reactions, such as nucleophilic addition, substitution, and rearrangement reactions, enabling the formation of diverse organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, methyl 1-cyanocyclobutanecarboxylate is used as a building block for the development of new drugs. Its ability to form stable intermediates and participate in complex chemical reactions makes it a valuable component in the synthesis of pharmaceutical compounds with potential therapeutic applications.
Used in Agrochemical Industry:
Methyl 1-cyanocyclobutanecarboxylate is also utilized in the agrochemical industry as a precursor for the synthesis of various agrochemicals, such as pesticides and herbicides. Its reactivity and compatibility with other chemical groups make it suitable for the development of effective and environmentally friendly agrochemical products.
Used in Material Science:
In the field of material science, methyl 1-cyanocyclobutanecarboxylate is employed as a monomer or intermediate in the synthesis of advanced polymers and materials. Its unique structure and reactivity contribute to the development of materials with specific properties, such as high strength, flexibility, or thermal stability, for various applications, including automotive, aerospace, and electronics industries.
Storage
Methyl 1-cyanocyclobutanecarboxylate should sealed in dry,2-8°C.
Check Digit Verification of cas no
The CAS Registry Mumber 58920-79-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,8,9,2 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 58920-79:
(7*5)+(6*8)+(5*9)+(4*2)+(3*0)+(2*7)+(1*9)=159
159 % 10 = 9
So 58920-79-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2/c1-10-6(9)7(5-8)3-2-4-7/h2-4H2,1H3
58920-79-9Relevant articles and documents
Ligand and metal complex
-
Page/Page column 7-8, (2011/04/18)
A ligand of Formula (I) is provided: wherein A4 represents a hydrogen atom, a nitro group, an amino group, a thiocyanato group, or —Z—Y, in which Z is a divalent linking group and Y is a group derived from a biocompatible molecule, with the proviso that when X is methylene, A4 cannot be a hydrogen atom or a nitro group. A metal complex having the ligand is also provided and is useful as a blood pool contrast agent or a targeting contrast agent.
Cycloalkyl triamine pentacarboxylate as ligands for paramagnetic metal complexes
-
Page/Page column 4; 7; sheet 1, (2010/11/28)
A cycloalkyl triamine pentacarboxylate compound coordinating to a metal ion to form a high stability metal complex in serum is provided. The metal complex of the present invention can be used as a contrast agent for magnetic resonance imaging (MRI).
