55324-97-5 Usage
Description
6-AMINO-6-DEOXY-D-GLUCOSE HYDROCHLORIDE, also known as an amino sugar, is a white solid with unique chemical properties. It plays a significant role in the synthesis of various compounds, particularly alkylating nitrogen mustards, which have been studied for their potential anti-tumor activity and irreversible enzyme inhibition.
Uses
Used in Pharmaceutical Industry:
6-AMINO-6-DEOXY-D-GLUCOSE HYDROCHLORIDE is used as a key intermediate for the synthesis of alkylating nitrogen mustards. These compounds are crucial in the development of potential anti-tumor agents and irreversible enzyme inhibitors, which can be employed in the treatment of various types of cancer.
Used in Research and Development:
In the field of research and development, 6-AMINO-6-DEOXY-D-GLUCOSE HYDROCHLORIDE serves as a valuable compound for studying the mechanisms of action and potential applications of alkylating nitrogen mustards. This knowledge can contribute to the advancement of cancer therapies and the development of novel drugs targeting specific enzymes.
Used in Chemical Synthesis:
6-AMINO-6-DEOXY-D-GLUCOSE HYDROCHLORIDE is also used as a starting material or building block in the synthesis of various other chemical compounds. Its unique structure and properties make it a versatile component in the creation of new molecules with potential applications in various industries, including pharmaceuticals, materials science, and biotechnology.
Check Digit Verification of cas no
The CAS Registry Mumber 55324-97-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,3,2 and 4 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 55324-97:
(7*5)+(6*5)+(5*3)+(4*2)+(3*4)+(2*9)+(1*7)=125
125 % 10 = 5
So 55324-97-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H13NO5/c7-1-3(9)5(11)6(12)4(10)2-8/h2-6,9-12H,1,7H2/p+1/t3-,4+,5-,6-/m1/s1
55324-97-5Relevant articles and documents
Method for stabilizing proteins with saccharide linked protein polymer conjugates
-
, (2008/06/13)
A method is disclosed for preparing water soluble protein polymer conjugates which stabilize the protein so as to retain functional properties in a hostile environment. The method comprises covalently bonding the polymer to the protein through at least three linkers which linkers have three or more hydroxyl groups. The protein is conjugated at lysines or arginines.
