526-62-5 Usage
Description
2,5-DIAZIRIDINYL-1,4-BENZOQUINONE is a member of the 1,4-benzoquinone class, specifically p-benzoquinone, where the hydrogens at positions 2 and 5 are replaced by aziridin-1-yl groups. This chemical compound is characterized by its unique structure and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2,5-DIAZIRIDINYL-1,4-BENZOQUINONE is used as a pharmaceutical compound for its potential therapeutic properties. The unique structure of this compound allows it to interact with specific biological targets, making it a promising candidate for the development of new drugs and therapies.
Used in Chemical Research:
In the field of chemical research, 2,5-DIAZIRIDINYL-1,4-BENZOQUINONE serves as a valuable compound for studying the properties and reactivity of 1,4-benzoquinones and aziridinyl groups. Its unique structure can provide insights into the behavior of similar compounds and contribute to the advancement of chemical knowledge.
Used in Material Science:
2,5-DIAZIRIDINYL-1,4-BENZOQUINONE may also find applications in material science, particularly in the development of new materials with specific properties. 2,5-DIAZIRIDINYL-1,4-BENZOQUINONE's unique structure could be utilized to create materials with enhanced characteristics, such as improved stability, reactivity, or selectivity.
Used in Environmental Applications:
2,5-DIAZIRIDINYL-1,4-BENZOQUINONE may also be employed in environmental applications, such as the degradation of pollutants or the development of new methods for environmental remediation. The unique properties of 2,5-DIAZIRIDINYL-1,4-BENZOQUINONE could be harnessed to address environmental challenges and contribute to a more sustainable future.
Safety Profile
Poison by intraperitoneal route.Human mutation data reported. When heated todecomposition it emits toxic fumes of NOx.
Check Digit Verification of cas no
The CAS Registry Mumber 526-62-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,2 and 6 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 526-62:
(5*5)+(4*2)+(3*6)+(2*6)+(1*2)=65
65 % 10 = 5
So 526-62-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O2/c13-9-6-8(12-3-4-12)10(14)5-7(9)11-1-2-11/h5-6H,1-4H2
