49810-41-5 Usage
Description
Ethyl 3,4,6-Tri-O-acetyl-2-acetamido-2-deoxy-a-Dthioglucopyranoside is a white powder chemical compound that serves as a valuable reagent in the synthesis of N-acetylglucosamine (GlcNAc) glycosides. It is characterized by its unique chemical structure, which allows for the formation of various glycosidic linkages in the preparation of complex carbohydrates and related biomolecules.
Uses
Used in Pharmaceutical Industry:
Ethyl 3,4,6-Tri-O-acetyl-2-acetamido-2-deoxy-a-Dthioglucopyranoside is used as a key intermediate in the synthesis of GlcNAc glycosides for the pharmaceutical industry. Ethyl 3,4,6-Tri-O-acetyl-2-acetamido-2-deoxy-a-Dthioglucopyranoside plays a crucial role in the development of drugs targeting various diseases, including cancer and inflammatory disorders, due to the importance of GlcNAc glycosides in cellular recognition and signaling processes.
Used in Chemical Research:
In the field of chemical research, Ethyl 3,4,6-Tri-O-acetyl-2-acetamido-2-deoxy-a-Dthioglucopyranoside is utilized as a versatile building block for the creation of complex carbohydrate structures. Its unique chemical properties enable researchers to explore novel synthetic pathways and develop innovative strategies for the preparation of bioactive molecules with potential applications in medicine, biotechnology, and materials science.
Used in Glycobiology:
Ethyl 3,4,6-Tri-O-acetyl-2-acetamido-2-deoxy-a-Dthioglucopyranoside is employed as a fundamental reagent in the field of glycobiology, which focuses on the study of carbohydrates and their interactions with other biomolecules. Ethyl 3,4,6-Tri-O-acetyl-2-acetamido-2-deoxy-a-Dthioglucopyranoside is essential for understanding the role of glycosylation in various biological processes, such as cell adhesion, immune response, and protein folding, and for developing new therapeutic approaches based on glycoside structures.
Check Digit Verification of cas no
The CAS Registry Mumber 49810-41-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 4,9,8,1 and 0 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 49810-41:
(7*4)+(6*9)+(5*8)+(4*1)+(3*0)+(2*4)+(1*1)=135
135 % 10 = 5
So 49810-41-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H25NO8S/c1-6-26-16-13(17-8(2)18)15(24-11(5)21)14(23-10(4)20)12(25-16)7-22-9(3)19/h12-16H,6-7H2,1-5H3,(H,17,18)/t12?,13-,14+,15+,16+/m0/s1
49810-41-5Relevant articles and documents
Facile Preparation of Glycosyl Donors for Oligosaccharide Synthesis: 2-Azido-2-deoxyhexopyranosyl Building Blocks
Buskas, Therese,Garegg, Per J.,Konradsson, Peter,Maloisel, Jean-Luc
, p. 2187 - 2194 (2007/10/02)
Facile routes to the 2-azido-2-deoxy-1-thioglycosides 6, 7, 15, and 18 and of the 2-azido-2-deoxy-4-pentenoglycoside 11, are described.These are useful intermediates for the synthesis of oligo-saccharides containing α-D-2-amino-2-deoxy (or 2-acetamido-2-d