482-01-9 Usage
Description
3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-chroman-4-one, also known as a dihydroxyflavanone, is a type of flavanone that is substituted by hydroxy groups at positions 5 and 7 and methoxy groups at positions 2' and 4' respectively. It is a naturally occurring compound with potential applications in various industries due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-chroman-4-one is used as a pharmaceutical compound for its potential therapeutic effects. 3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-chroman-4-one's unique structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs. Its antioxidant and anti-inflammatory properties may contribute to its potential use in treating various diseases and conditions.
Used in Cosmetic Industry:
In the cosmetic industry, 3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-chroman-4-one is used as an active ingredient for its antioxidant and anti-aging properties. Its ability to neutralize free radicals and protect the skin from environmental damage makes it a valuable addition to skincare products. Additionally, its potential to improve skin elasticity and reduce the appearance of fine lines and wrinkles contributes to its use in anti-aging formulations.
Used in Food and Beverage Industry:
3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-chroman-4-one can be used in the food and beverage industry as a natural antioxidant to extend the shelf life of products and maintain their freshness. Its ability to protect against lipid oxidation and prevent the formation of harmful compounds makes it a valuable additive for the industry. Furthermore, its potential to enhance the flavor and aroma of certain products may also contribute to its use in the food and beverage sector.
Used in Agricultural Industry:
In agriculture, 3-(2,4-dimethoxyphenyl)-5,7-dihydroxy-chroman-4-one may be used as a natural pesticide or fungicide due to its antimicrobial properties. Its ability to inhibit the growth of harmful microorganisms and protect crops from diseases could make it a valuable tool in sustainable agriculture practices. Additionally, its potential to enhance the nutritional value of crops by improving their antioxidant content may also contribute to its use in the agricultural industry.
Check Digit Verification of cas no
The CAS Registry Mumber 482-01-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 2 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 482-01:
(5*4)+(4*8)+(3*2)+(2*0)+(1*1)=59
59 % 10 = 9
So 482-01-9 is a valid CAS Registry Number.
InChI:InChI=1/C17H16O6/c1-21-10-3-4-11(14(7-10)22-2)12-8-23-15-6-9(18)5-13(19)16(15)17(12)20/h3-7,12,18-19H,8H2,1-2H3