473278-54-5 Usage
Description
2'-O-(2-Methoxyethyl)guanosine is a guanosine derivative that is synthesized through the reaction of 2-aminoadenosine with methylsulfonyl chloride. It is characterized by the presence of a 2-methoxyethyl group at the 2'-O position, which imparts unique properties to the molecule. This modification allows it to be used as a versatile building block in the synthesis of cross-linking oligonucleotides, offering potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2'-O-(2-Methoxyethyl)guanosine is used as a building block for cross-linking oligonucleotides for the development of novel therapeutic agents. Its unique structure enables the formation of stable cross-links between oligonucleotides, which can be utilized in the design of drugs targeting specific RNA or DNA sequences. This can lead to the development of targeted therapies for various diseases, including cancer and genetic disorders.
Used in Research and Development:
In the field of research and development, 2'-O-(2-Methoxyethyl)guanosine serves as a valuable tool for studying the structure, function, and interactions of nucleic acids. Its ability to form cross-links between oligonucleotides can be used to investigate the mechanisms of gene regulation, RNA processing, and other biological processes. Additionally, it can be employed in the development of new techniques for nucleic acid manipulation and analysis.
Used in Diagnostic Applications:
2'-O-(2-Methoxyethyl)guanosine can also be utilized in the development of diagnostic tools and assays. Its ability to form cross-links with nucleic acids can be harnessed to create highly specific and sensitive detection methods for various genetic and infectious diseases. This can lead to improved diagnostic capabilities and more effective disease management.
Check Digit Verification of cas no
The CAS Registry Mumber 473278-54-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,7,3,2,7 and 8 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 473278-54:
(8*4)+(7*7)+(6*3)+(5*2)+(4*7)+(3*8)+(2*5)+(1*4)=175
175 % 10 = 5
So 473278-54-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H19N5O6/c1-22-2-3-23-9-8(20)6(4-19)24-12(9)18-5-15-7-10(18)16-13(14)17-11(7)21/h5-6,8-9,12,19-20H,2-4H2,1H3,(H3,14,16,17,21)/t6-,8+,9+,12-/m1/s1