4472-41-7 Usage
Description
N,N-Dimethylformamide-d7 (DMF-d7) is a deuterated NMR solvent containing 0.03% (v/v) TMS (tetramethylsilane). It is a liquid with unique properties that make it useful in NMR-based research and analyses, particularly for studying the solvation of ions and other chemical processes.
Uses
Used in NMR Spectroscopy:
N,N-Dimethylformamide-d7 is used as a common solvent for NMR spectroscopy due to its ability to provide clear and accurate results in various chemical analyses.
Used in Metabolism Studies:
N,N-Dimethylformamide-d7 is used as a reagent to study the metabolism of certain compounds, such as in the case of rats, by employing 2H NMR spectroscopy. This allows researchers to gain insights into the metabolic processes and understand the underlying mechanisms.
Used in Chemical Property Analysis:
N,N-Dimethylformamide-d7 is utilized in the investigation of chloride ion solvation through pulsed neutron diffraction measurements of different concentrations of molar lithium chloride (LiCl) solutions in DMF-d7. This helps in understanding the interactions between ions and solvents, which is crucial for various chemical and industrial applications.
Used in Chemical Research and Development:
In the chemical industry, N,N-Dimethylformamide-d7 serves as a valuable reagent for conducting research and development activities. Its deuterated nature and compatibility with NMR spectroscopy make it an essential tool for studying various chemical reactions and processes, leading to the development of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 4472-41-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 4,4,7 and 2 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 4472-41:
(6*4)+(5*4)+(4*7)+(3*2)+(2*4)+(1*1)=87
87 % 10 = 7
So 4472-41-7 is a valid CAS Registry Number.
InChI:InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3
