39300-87-3 Usage
Description
GALACTAN, a type of hemicellulose, is a cream-colored powder extracted from various plant sources, including hybrids of Pennisetum and edible mushrooms. It is a polysaccharide that plays a crucial role in the structure and function of plant cell walls, contributing to their mechanical strength and resistance to biotic and abiotic stresses.
Uses
Used in Pharmaceutical Industry:
GALACTAN is used as a pharmaceutical ingredient for its potential therapeutic applications. Its unique chemical properties and biocompatibility make it a promising candidate for the development of new drugs and therapies.
Used in Food Industry:
GALACTAN is used as a functional ingredient in the food industry, where it serves as a stabilizer, emulsifier, and thickener. Its ability to improve the texture and consistency of various food products makes it a valuable addition to the industry.
Used in Cosmetics Industry:
GALACTAN is used as a key ingredient in the cosmetics industry, where it is valued for its moisturizing and skin-conditioning properties. It can be found in various skincare products, such as creams, lotions, and serums, to provide hydration and improve the overall appearance of the skin.
Used in Biotechnology:
GALACTAN is used in biotechnology applications, such as tissue engineering and drug delivery systems. Its biocompatibility and ability to interact with biopolymers make it an ideal candidate for the development of novel biomaterials and scaffolds for tissue regeneration and repair.
Used in Agriculture:
GALACTAN is used in agriculture as a component of plant cell walls, providing structural support and protection against environmental stresses. It also plays a role in plant-pathogen interactions, contributing to the plant's defense mechanisms against various diseases and pests.
Check Digit Verification of cas no
The CAS Registry Mumber 39300-87-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 3,9,3,0 and 0 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 39300-87:
(7*3)+(6*9)+(5*3)+(4*0)+(3*0)+(2*8)+(1*7)=113
113 % 10 = 3
So 39300-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C20H36O16/c1-30-15-6(3-21)33-19(13(28)9(15)24)36-17-8(5-23)34-20(14(29)11(17)26)35-16-7(4-22)32-18(31-2)12(27)10(16)25/h6-29H,3-5H2,1-2H3/t6-,7-,8-,9+,10-,11-,12+,13+,14+,15-,16+,17-,18-,19+,20+/m0/s1