371943-13-4 Usage
Organic compound
It is a carbon-based compound, consisting of a complex network of carbon atoms bonded to other elements such as hydrogen, nitrogen, and oxygen.
Amino acid derivative
The compound is derived from the amino acid pyrrolidine, which is a building block for proteins in living organisms.
Pharmaceutical research and drug development
This compound is commonly used in the field of pharmaceuticals to study and develop new drugs and medicinal products.
Medicinal chemistry applications
The compound has potential applications in medicinal chemistry, particularly in the synthesis of new drugs and pharmaceutical products.
Interaction with biological targets
1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid, 3-amino-, ethyl ester is known for its ability to interact with biological targets, making it a promising candidate for the development of new therapeutic agents.
Development of new therapeutic agents
The compound has shown promise in the development of new drugs and treatments, potentially leading to breakthroughs in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 371943-13-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 3,7,1,9,4 and 3 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 371943-13:
(8*3)+(7*7)+(6*1)+(5*9)+(4*4)+(3*3)+(2*1)+(1*3)=154
154 % 10 = 4
So 371943-13-4 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3O2/c1-2-15-10(14)8-7(11)6-4-3-5-12-9(6)13-8/h3-5H,2,11H2,1H3,(H,12,13)
