3017-70-7 Usage
Description
2-Bromo-3-methyl-2-butene is a vinylic bromide compound characterized by its unique chemical structure and reactivity. It is known for its potential in various chemical reactions and applications, particularly in the synthesis of complex organic molecules and pharmaceutical compounds.
Uses
Used in Chemical Synthesis:
2-Bromo-3-methyl-2-butene is used as a key intermediate in the synthesis of various organic compounds, including:
1. 2,3,4,5-tetramethyl-2,4-hexadiene, which is an important building block for the creation of complex organic molecules and polymers.
2. 2-iodo-3-methyl-2-butenediastereomers of 2-amino-3-hydroxy-4,5-dimethylhexanoic acid, which are valuable for the development of novel pharmaceuticals and bioactive molecules.
3. Lithium reagent, 2-lithio-3-methylbut-2-ene, which serves as a versatile starting material for the preparation of various organic compounds through lithiation reactions.
Used in Pharmaceutical Industry:
2-Bromo-3-methyl-2-butene is used as a crucial component in the synthesis of D-allo-(2R,3R,4R)-2-amino-3-hydroxy-4,5-dimethylhexanoic acid-containing peptide, pipecolidepsin A. This peptide has potential applications in the development of new drugs and therapies for various medical conditions.
Additionally, the compound has been investigated for its potential in cross-coupling reactions with potassium 6-(benzoyloxy)hexyltrifluoroborate and 3-(benzoyloxy)propyltrifluoroborate, which can lead to the formation of new organic compounds with diverse applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 3017-70-7 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 3,0,1 and 7 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 3017-70:
(6*3)+(5*0)+(4*1)+(3*7)+(2*7)+(1*0)=57
57 % 10 = 7
So 3017-70-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H9Br/c1-4(2)5(3)6/h1-3H3
