269396-55-6 Usage
General Description
"(R)-3-AMINO-4-(3,4-DICHLOROPHENYL)BUTANOIC ACID HYDROCHLORIDE" is a specific chemical compound, which, by its name, can be understood to have a structure comprised of an amino group, a hydrochrolic acid group, and a butanoic acid residue with a dichlorophenyl ring attached. It is chiral, indicated by the (R) sign which refers to Rectus, meaning the molecule has a specific orientation in three-dimensional space. As a butanoic acid derivative, it has the potential to exhibit biological and chemical properties but without further details or context, it’s hard to determine its specific applications or qualities. The exact properties, uses, and safety data of this compound can primarily be determined through laboratory synthesis, testing or analysis.
Check Digit Verification of cas no
The CAS Registry Mumber 269396-55-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,9,3,9 and 6 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 269396-55:
(8*2)+(7*6)+(6*9)+(5*3)+(4*9)+(3*6)+(2*5)+(1*5)=196
196 % 10 = 6
So 269396-55-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H11Cl2NO2.ClH/c11-8-2-1-6(4-9(8)12)3-7(13)5-10(14)15;/h1-2,4,7H,3,5,13H2,(H,14,15);1H/t7-;/m1./s1