26426-80-2 Usage
Description
POLY(ISOBUTYLENE-ALT-MALEIC ANHYDRIDE) is a copolymer that consists of alternating isobutylene and maleic anhydride units. It is known for its unique properties, such as its ability to form hydrogen bonds and its amphiphilic nature, which makes it suitable for various applications in different industries.
Uses
Used in Dispersing and Surface Active Agents:
POLY(ISOBUTYLENE-ALT-MALEIC ANHYDRIDE) is used as a dispersing and surface active agent due to its ability to form hydrogen bonds and its amphiphilic nature. This makes it effective in stabilizing and dispersing various substances in different mediums.
Used in Amphiphilic Polymer Preparation:
POLY(ISOBUTYLENE-ALT-MALEIC ANHYDRIDE) is used in the preparation of amphiphilic polymers, such as the one prepared with dodecylamine. The resulting polymer exhibits both hydrophilic and hydrophobic properties, making it useful in various applications, such as drug delivery, emulsification, and stabilization of colloidal systems.
Check Digit Verification of cas no
The CAS Registry Mumber 26426-80-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,6,4,2 and 6 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 26426-80:
(7*2)+(6*6)+(5*4)+(4*2)+(3*6)+(2*8)+(1*0)=112
112 % 10 = 2
So 26426-80-2 is a valid CAS Registry Number.
InChI:InChI=1/C4H2O3.C4H8/c5-3-1-2-4(6)7-3;1-4(2)3/h1-2H;1H2,2-3H3