261762-50-9 Usage
General Description
2-CHLORO-3,6-DIFLUOROPHENOL 97 is a chemical compound that is primarily used in the production of pharmaceuticals, agrochemicals, and other industrial products. It is a highly reactive and corrosive substance, which makes it suitable for a wide range of applications. The compound is known for its strong antibacterial and antifungal properties, making it an essential ingredient in the production of disinfectants and preservatives. It is also used in the manufacturing of pesticides and herbicides due to its potent insecticidal properties. Additionally, 2-CHLORO-3,6-DIFLUOROPHENOL 97 is used in the synthesis of various organic compounds and as a chemical intermediate in the production of other specialty chemicals. Overall, this chemical compound plays a crucial role in the pharmaceutical, agricultural, and industrial sectors due to its versatile properties and wide range of applications.
Check Digit Verification of cas no
The CAS Registry Mumber 261762-50-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,6,1,7,6 and 2 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 261762-50:
(8*2)+(7*6)+(6*1)+(5*7)+(4*6)+(3*2)+(2*5)+(1*0)=139
139 % 10 = 9
So 261762-50-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H3ClF2O/c7-5-3(8)1-2-4(9)6(5)10/h1-2,10H
