25474-85-5 Usage
Description
4-Methoxybenzyloxycarbonyl azide is a chemical compound that is commonly used as a protecting group in organic synthesis. It is characterized by the presence of an azide group attached to a 4-methoxybenzyl ether moiety, which can be easily removed under mild conditions to yield the desired product.
Uses
Used in Organic Synthesis:
4-Methoxybenzyloxycarbonyl azide is used as a protecting group for amines and other functional groups during organic synthesis. It provides a stable and easily removable protecting group that can be selectively removed under mild conditions, allowing for the synthesis of complex molecules with minimal side reactions.
Used in Peptide Synthesis:
In peptide synthesis, 4-Methoxybenzyloxycarbonyl azide is used as a protecting group for the α-amino group of amino acids. This allows for the stepwise addition of amino acids to a growing peptide chain without unwanted side reactions. The protecting group can be removed at the end of the synthesis to yield the desired peptide.
Used in Pharmaceutical Industry:
4-Methoxybenzyloxycarbonyl azide is used in the synthesis of pharmaceutical compounds, where it serves as a protecting group for amines and other functional groups. This allows for the selective modification of the compound and the synthesis of complex drug molecules with improved properties.
Used in Research and Development:
4-Methoxybenzyloxycarbonyl azide is used in research and development for the synthesis of novel compounds and the study of reaction mechanisms. Its selective and mild deprotection properties make it a valuable tool in the synthesis of complex organic molecules and the investigation of chemical reactions.
Check Digit Verification of cas no
The CAS Registry Mumber 25474-85-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,5,4,7 and 4 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 25474-85:
(7*2)+(6*5)+(5*4)+(4*7)+(3*4)+(2*8)+(1*5)=125
125 % 10 = 5
So 25474-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H10N3O3/c1-14-8-4-2-7(3-5-8)6-15-9(13)11-12-10/h2-5,10H,6H2,1H3/q+1