23468-31-7 Usage
Description
6-Chloropiperonyl Chloride, also known as 6-chloro-2-piperidinyl dichloride, is a white crystalline powder with chemical properties that make it a versatile compound in various industries. It is primarily recognized for its role as a pharmaceutical intermediate, contributing to the synthesis of a wide range of pharmaceutical products.
Uses
Used in Pharmaceutical Industry:
6-Chloropiperonyl Chloride is used as a pharmaceutical intermediate for the synthesis of various medications. Its chemical properties allow it to be a key component in the development of drugs that target different medical conditions, making it an essential compound in the pharmaceutical sector.
As a chemical intermediate, 6-Chloropiperonyl Chloride plays a crucial role in the production of various pharmaceuticals, contributing to the development of new and innovative treatments for a wide range of health issues. Its versatility and chemical properties make it a valuable asset in the pharmaceutical industry, driving advancements in medical research and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 23468-31-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,3,4,6 and 8 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 23468-31:
(7*2)+(6*3)+(5*4)+(4*6)+(3*8)+(2*3)+(1*1)=107
107 % 10 = 7
So 23468-31-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H6Cl2O2/c9-3-5-1-7-8(2-6(5)10)12-4-11-7/h1-2H,3-4H2