21531-96-4 Usage
Description
4-Amino-(4H)-1,2,4-Triazole-3,5-Diol is a heterocyclic chemical compound with the molecular formula C2H4N4O2. It features both an amino group and hydroxyl groups, contributing to its versatile chemical properties and making it a valuable component in various industrial and scientific applications.
Uses
Used in Pharmaceutical Industry:
4-Amino-(4H)-1,2,4-Triazole-3,5-Diol is used as a building block for the synthesis of pharmaceutical drugs. Its unique structure allows it to be incorporated into a variety of drug molecules, enhancing their therapeutic properties and effectiveness.
Used in Agricultural Industry:
In agriculture, 4-Amino-(4H)-1,2,4-Triazole-3,5-Diol serves as a precursor for the production of herbicides and fungicides. Its chemical properties make it suitable for the development of compounds that can effectively control the growth of unwanted plants and fungi, thus protecting crops.
Used in Dye Production:
4-Amino-(4H)-1,2,4-Triazole-3,5-Diol is utilized in the production of dyes due to its ability to form stable color compounds. This makes it a valuable component in the creation of dyes for various applications, including textiles and other industrial processes.
Used as a Research Reagent:
In the field of scientific research, 4-Amino-(4H)-1,2,4-Triazole-3,5-Diol is employed as a reagent in chemical synthesis. Its versatile properties make it an essential tool for researchers working on the development of new compounds and materials.
Check Digit Verification of cas no
The CAS Registry Mumber 21531-96-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,5,3 and 1 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 21531-96:
(7*2)+(6*1)+(5*5)+(4*3)+(3*1)+(2*9)+(1*6)=84
84 % 10 = 4
So 21531-96-4 is a valid CAS Registry Number.
InChI:InChI=1/C2H4N4O2/c3-6-1(7)4-5-2(6)8/h3H2,(H,4,7)(H,5,8)
