21203-78-1 Usage
Description
2-BROMO-6-NITROPYRIDINE is an organic compound that belongs to the class of halogen-substituted pyridine derivatives. It is characterized by the presence of a bromine atom at the 2nd position and a nitro group at the 6th position on the pyridine ring. 2-BROMO-6-NITROPYRIDINE is known for its unique chemical properties and potential applications in various fields.
Uses
Used in Chemical Research:
2-BROMO-6-NITROPYRIDINE is used as a research compound for studying the Conductor-like Polarizable Continuum Solvation Model (C-PCM). This model is a computational method used to predict the solvation effects on molecules in different solvents, which is crucial for understanding the behavior of molecules in various environments.
Used in Pharmaceutical Industry:
2-BROMO-6-NITROPYRIDINE is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Material Science:
2-BROMO-6-NITROPYRIDINE can be used as a building block in the development of new materials with specific properties, such as improved conductivity or enhanced stability.
Check Digit Verification of cas no
The CAS Registry Mumber 21203-78-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 2,1,2,0 and 3 respectively; the second part has 2 digits, 7 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 21203-78:
(7*2)+(6*1)+(5*2)+(4*0)+(3*3)+(2*7)+(1*8)=61
61 % 10 = 1
So 21203-78-1 is a valid CAS Registry Number.
InChI:InChI=1/C5H3BrN2O2/c6-4-2-1-3-5(7-4)8(9)10/h1-3H
21203-78-1Relevant articles and documents
Unusual nitro-coordination of europium(iii) and terbium(iii) with pyridinyl ligands
De Bettencourt-Dias, Ana,Bauer, Sebastian,Viswanathan, Subha,Maull, Brandi C.,Ako, Ayuk M.
, p. 11212 - 11218 (2012)
A new ligand family based on picoline, bipyridine and terpyridine containing a nitro moiety has been synthesized and its coordination and sensitization ability for lanthanide ions has been studied. Three new complexes were characterized by X-ray single crystal diffraction and all three show uncommon coordination of the nitro moiety to the lanthanide ion. 5cTb, a terpyridine-nitro derivative with Tb(NO3)3, crystallizes in the orthorhombic space group Pbca with a = 15.125(3), b = 13.776(3), c = 18.716(4) A, and V = 3899.8(13) A3 and is isostructural with its Eu(iii) analog (5cEu) with cell parameters a = 15.1341(4), b = 13.7070(4), c = 18.8277(5) A. 6Eu, a tripodal amine with a nitro-derivatized pyridine with Eu(CF3SO3)3, crystallizes in the triclinic space group P1 with a = 11.067(2), b = 11.633(2), c = 12.772(3) A, α = 110.94(3), β = 97.49(3), γ = 91.42(3)° and V = 1518.1(5) A3. Finally, ligand 5a, a bipyridine-nitro derivative, crystallizes in the orthorhombic space group P21/n with a = 3.7128(3), b = 11.7806(8), c = 19.9856(14) A, β = 92.925(2)° and V = 873.01(11) A3. All four ligands show sensitization of Eu(iii) and Tb(iii) luminescence.
