210049-16-4 Usage
Description
4-Aminophenyl 2-acetamido-2-deoxy-alpha-D-galactopyranoside hydrochloride is a white solid compound that belongs to the class of glycoconjugates. It is a derivative of a sugar molecule, specifically a deoxy sugar, with an attached aminophenyl group and an acetamido group. 4-Aminophenyl 2-acetamido-2-deoxy-alpha-D-galactopyranoside hydrochloride is characterized by its unique chemical structure, which allows it to be utilized in various applications, particularly in the field of synthetic chemistry.
Uses
Used in Synthetic Preparation:
4-Aminophenyl 2-acetamido-2-deoxy-alpha-D-galactopyranoside hydrochloride is used as a synthetic intermediate for the preparation of various complex organic molecules, including those with potential pharmaceutical and biological applications. Its unique structure makes it a valuable building block in the synthesis of novel compounds, particularly those involving glycosylation reactions.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Aminophenyl 2-acetamido-2-deoxy-alpha-D-galactopyranoside hydrochloride is used as a key component in the development of new drugs targeting various diseases. Its ability to form glycosidic bonds with other molecules makes it an attractive candidate for the creation of glycoconjugate drugs, which have shown promise in treating a range of conditions, including cancer, infectious diseases, and autoimmune disorders.
Used in Chemical Research:
4-Aminophenyl 2-acetamido-2-deoxy-alpha-D-galactopyranoside hydrochloride is also used in chemical research as a model compound for studying the properties and reactivity of glycoconjugates. Researchers can use this compound to investigate the effects of various functional groups on the overall reactivity and stability of the molecule, as well as to explore new synthetic routes and methodologies for the preparation of complex glycoconjugates.
Used in Material Science:
In the field of material science, 4-Aminophenyl 2-acetamido-2-deoxy-alpha-D-galactopyranoside hydrochloride can be used as a component in the development of novel materials with specific properties. For example, its ability to form hydrogen bonds and interact with other molecules can be exploited to create materials with enhanced mechanical, thermal, or electrical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 210049-16-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 2,1,0,0,4 and 9 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 210049-16:
(8*2)+(7*1)+(6*0)+(5*0)+(4*4)+(3*9)+(2*1)+(1*6)=74
74 % 10 = 4
So 210049-16-4 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N2O6/c1-7(18)16-11-13(20)12(19)10(6-17)22-14(11)21-9-4-2-8(15)3-5-9/h2-5,10-14,17,19-20H,6,15H2,1H3,(H,16,18)/t10?,11-,12-,13+,14-/m0/s1
