19060-15-2 Usage
Description
4-Aminobutyraldehyde dimethyl acetal is an organic compound that serves as a crucial intermediate in various organic synthesis processes. It is characterized by its reactivity and ability to form derivatives, making it a versatile compound in the field of chemistry.
Uses
Used in Pharmaceutical Industry:
4-Aminobutyraldehyde dimethyl acetal is used as an intermediate for the synthesis of various pharmaceutical compounds. Its primary applications include the preparation of the pineal hormone melatonin, which is essential for regulating sleep-wake cycles and other physiological processes. The compound is reacted with 4-methoxyphenylhydrazine hydrochloride and acetic anhydride to produce melatonin.
Additionally, 4-aminobutyraldehyde dimethyl acetal is used in the preparation of other pharmaceutical compounds such as ficuseptine, juliprosine, and juliprosopine. These compounds have potential applications in the treatment of various medical conditions, highlighting the importance of 4-aminobutyraldehyde dimethyl acetal in the development of novel therapeutic agents.
Check Digit Verification of cas no
The CAS Registry Mumber 19060-15-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,9,0,6 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 19060-15:
(7*1)+(6*9)+(5*0)+(4*6)+(3*0)+(2*1)+(1*5)=92
92 % 10 = 2
So 19060-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H15NO2/c1-8-6(9-2)4-3-5-7/h6H,3-5,7H2,1-2H3/p+1