175276-85-4 Usage
General Description
2-(4-Fluorobenzylsulfonyl)acetamidoxime is a chemical compound that belongs to the class of organic compounds known as N-acylamidines. It is a white to light yellow powder that is often utilized as a pharmaceutical intermediate in the synthesis of various drugs. 2-(4-FLUOROBENZYLSULFONYL)ACETAMIDOXIME is known for its potential as a chelating agent, and it has been studied for its potential use in the treatment of metal poisoning. Additionally, it has been investigated for its potential antimicrobial and antifungal properties. However, further research is needed to fully understand the potential uses and safety of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 175276-85-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,5,2,7 and 6 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 175276-85:
(8*1)+(7*7)+(6*5)+(5*2)+(4*7)+(3*6)+(2*8)+(1*5)=164
164 % 10 = 4
So 175276-85-4 is a valid CAS Registry Number.
InChI:InChI=1/C7H5F2NS/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,(H2,10,11)