17343-03-2 Usage
General Description
Glycyl-D-aspartic acid, also known as Gly-D-Asp or GD, is a dipeptide composed of glycine and D-aspartic acid. It is often used in research and pharmaceutical applications due to its potential role in cell adhesion and signaling processes. Gly-D-Asp has been shown to bind to integrin receptors on cell surfaces, potentially influencing cell migration and proliferation. Its ability to form stable complexes with metal ions also makes it a valuable chelating agent. Additionally, Gly-D-Asp has been studied for its potential to improve bone regeneration and wound healing, making it a promising compound in biomedical and tissue engineering fields.
Check Digit Verification of cas no
The CAS Registry Mumber 17343-03-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,7,3,4 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 17343-03:
(7*1)+(6*7)+(5*3)+(4*4)+(3*3)+(2*0)+(1*3)=92
92 % 10 = 2
So 17343-03-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H10N2O5/c7-2-4(9)8-3(6(12)13)1-5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)(H,12,13)/t3-/m1/s1
