171916-75-9 Usage
Description
(3AS)-5-AZIDO-7-BROMO-3A 4 5 7A-TETRAHY& is a chemical compound derived from a tetrahydropyrrolo[1,2-c]imidazole. It features an azide group at the 5-position and a bromo group at the 7-position, along with a tetrahydrofuran ring and a tetrahydrofuran-2-ylmethyl group. This unique combination of functional groups and the tetrahydropyrrolo[1,2-c]imidazole scaffold may offer potential applications in various fields such as organic synthesis, medicinal chemistry, and material science. Further research and investigation are necessary to determine the specific properties and uses of this compound.
Uses
Used in Organic Synthesis:
(3AS)-5-AZIDO-7-BROMO-3A 4 5 7A-TETRAHY& is used as a building block for the synthesis of more complex organic molecules due to its unique functional groups and structural features.
Used in Medicinal Chemistry:
(3AS)-5-AZIDO-7-BROMO-3A 4 5 7A-TETRAHY& is used as a starting material or intermediate in the development of new pharmaceutical compounds, potentially targeting various diseases and medical conditions.
Used in Material Science:
(3AS)-5-AZIDO-7-BROMO-3A 4 5 7A-TETRAHY& is used as a component in the creation of novel materials with specific properties, such as improved stability, reactivity, or selectivity, depending on the requirements of the application.
Check Digit Verification of cas no
The CAS Registry Mumber 171916-75-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,1,9,1 and 6 respectively; the second part has 2 digits, 7 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 171916-75:
(8*1)+(7*7)+(6*1)+(5*9)+(4*1)+(3*6)+(2*7)+(1*5)=149
149 % 10 = 9
So 171916-75-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BrN3O3/c1-9(2)15-7-4(10)3-5(12-13-11)6(14)8(7)16-9/h3,5-8,14H,1-2H3/t5-,6+,7+,8-/m0/s1