170108-05-1 Usage
General Description
2-Bromo-3,4-difluorobenzoic acid is a chemical compound that belongs to the class of benzoic acids, which are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science. This specific compound contains a benzene ring with two fluorine atoms and one bromine atom attached to it. It is used as a building block in the synthesis of various organic molecules, and it has been studied for its potential therapeutic properties. Additionally, its unique structure and properties make it a valuable tool in the field of organic chemistry for the development of new materials and drugs.
Check Digit Verification of cas no
The CAS Registry Mumber 170108-05-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,7,0,1,0 and 8 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 170108-05:
(8*1)+(7*7)+(6*0)+(5*1)+(4*0)+(3*8)+(2*0)+(1*5)=91
91 % 10 = 1
So 170108-05-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H3BrF2O2/c8-5-3(7(11)12)1-2-4(9)6(5)10/h1-2H,(H,11,12)