1655-65-8 Usage
General Description
DNP-L-Threonine is a chemical compound that is part of the amino acid family, specifically as a derivative of threonine. It is commonly used in the pharmaceutical and biochemical industries for its properties and functions in various biological processes. DNP-L-Threonine plays a crucial role in protein synthesis and is important for maintaining the overall health and well-being of an organism. It is also utilized as a component in the synthesis of peptides and proteins in lab settings. Additionally, DNP-L-Threonine has been the subject of scientific research for its potential pharmacological and therapeutic applications, particularly in the field of drug development and medical treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 1655-65-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,6,5 and 5 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1655-65:
(6*1)+(5*6)+(4*5)+(3*5)+(2*6)+(1*5)=88
88 % 10 = 8
So 1655-65-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3O7/c1-5(14)9(10(15)16)11-7-3-2-6(12(17)18)4-8(7)13(19)20/h2-5,9,11,14H,1H3,(H,15,16)/t5-,9+/m1/s1
