164654-49-3 Usage
Description
Dibenzyl N,N-dimethylphosphoramidite is an organic compound that serves as a synthetic reagent in various chemical reactions. It is characterized by its phosphoramidite functional group, which is a key component in the synthesis of certain biologically active molecules.
Uses
Used in Pharmaceutical Industry:
Dibenzyl N,N-dimethylphosphoramidite is used as a synthetic reagent for the enzyme-assisted synthesis of inositol triphosphate. Inositol triphosphate is an important second messenger in cellular signal transduction pathways, playing a crucial role in various physiological processes such as calcium mobilization and cell growth regulation. The enzyme-assisted synthesis facilitated by this reagent allows for the efficient production of inositol triphosphate, which can be further utilized in research and drug development.
Additionally, the reagent may also find applications in the synthesis of other biologically relevant molecules, given its ability to participate in various chemical reactions. Its versatility and reactivity make it a valuable tool in the field of organic chemistry and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 164654-49-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,6,4,6,5 and 4 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 164654-49:
(8*1)+(7*6)+(6*4)+(5*6)+(4*5)+(3*4)+(2*4)+(1*9)=153
153 % 10 = 3
So 164654-49-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H20NO2P/c1-17(2)20(18-13-15-9-5-3-6-10-15)19-14-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3
164654-49-3Relevant articles and documents
Dismutation of arylene phosphorodiamidites: Specific features and aspects of preparative use
Rasadkina,Slitikov,Nifant'ev
, p. 183 - 197 (2008/02/08)
The dismutation of arylene phosphorodiamidites derived from the simplest phenols and naphthols and of their dibasic analogs was studied. The main regular trends of this process and the limits of its synthetic applicability were determined. Pleiades Publishing, Inc., 2006.
