155806-35-2 Usage
Description
(R)-(S)-JOSIPHOS, also known as (R)-1-[(SP)-2-(diphenylphosphino)ferrocenyl]ethyldicyclohexylphosphine, is a chiral phosphine ligand used in various chemical reactions and processes. It is an orange crystalline powder sold in collaboration with Solvias AG. Its unique structure allows it to play a crucial role in the synthesis of various compounds, particularly in the field of organometallic chemistry.
Uses
Used in Organometallic Chemistry:
(R)-(S)-JOSIPHOS is used as a ligand in the preparation of cyclopentadienyliridium complexes, such as [IrCl(PP)]2 and [IrCp(PP)], where Cp represents cyclopentadienyl. The ligand's chiral nature and unique structure enable the formation of these complexes, which have potential applications in various fields, including catalysis and materials science.
Used in Pharmaceutical Industry:
(R)-(S)-JOSIPHOS may also find applications in the pharmaceutical industry, particularly in the development of new drugs and drug delivery systems. Its unique properties and reactivity can be harnessed to create novel compounds with potential therapeutic benefits.
Used in Catalyst Development:
In the field of catalysis, (R)-(S)-JOSIPHOS can be used as a ligand to develop new catalysts for various chemical reactions. Its chiral nature and ability to form stable complexes with metal centers make it a valuable component in the design of efficient and selective catalysts for industrial processes.
Used in Research and Development:
(R)-(S)-JOSIPHOS is also used in research and development laboratories, where it can be employed to study the properties and reactivity of chiral phosphine ligands. This knowledge can be applied to the development of new synthetic methods, materials, and technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 155806-35-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,5,5,8,0 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 155806-35:
(8*1)+(7*5)+(6*5)+(5*8)+(4*0)+(3*6)+(2*3)+(1*5)=142
142 % 10 = 2
So 155806-35-2 is a valid CAS Registry Number.
InChI:InChI=1/C31H39P2.C5H5.Fe/c1-25(32(26-15-6-2-7-16-26)27-17-8-3-9-18-27)30-23-14-24-31(30)33(28-19-10-4-11-20-28)29-21-12-5-13-22-29;1-2-4-5-3-1;/h4-5,10-14,19-27H,2-3,6-9,15-18H2,1H3;1-5H;/t25-;;/m1../s1