15548-61-5 Usage
Description
6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is a beta-D-glucoside that consists of beta-D-glucopyranose, where the anomeric hydroxy hydrogen is replaced by a 6-bromo-2-naphthyl group. It is a white to light yellow crystal powder and is known for its unique chemical properties.
Uses
Used in Pharmaceutical Industry:
6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a pharmaceutical compound for its potential therapeutic applications. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [pharmaceutical compound] for [potential therapeutic applications].
Used in Chemical Research:
In the field of chemical research, 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE serves as a valuable compound for studying its chemical properties and potential interactions with other molecules. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [chemical research compound] for [studying its properties and interactions].
Used in Analytical Chemistry:
6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE can be employed as a reference compound in analytical chemistry for the development and validation of analytical methods, such as high-performance liquid chromatography (HPLC) or mass spectrometry. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [reference compound] for [analytical method development and validation].
Used in Material Science:
The unique chemical properties of 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE make it a potential candidate for the development of new materials with specific characteristics, such as optical, electronic, or mechanical properties. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as a [material science compound] for [development of new materials with specific characteristics].
Used in Environmental Science:
6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE may be utilized in environmental science for the detection and monitoring of pollutants or as a component in the development of environmental sensors. The expression is: 6-BROMO-2-NAPHTHYL-BETA-D-GLUCOPYRANOSIDE is used as an [environmental science compound] for [pollutant detection and monitoring or sensor development].
Check Digit Verification of cas no
The CAS Registry Mumber 15548-61-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,5,5,4 and 8 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 15548-61:
(7*1)+(6*5)+(5*5)+(4*4)+(3*8)+(2*6)+(1*1)=115
115 % 10 = 5
So 15548-61-5 is a valid CAS Registry Number.
InChI:InChI=1/C16H17BrO6/c17-10-3-1-9-6-11(4-2-8(9)5-10)22-16-15(21)14(20)13(19)12(7-18)23-16/h1-6,12-16,18-21H,7H2/t12-,13+,14+,15-,16-/m0/s1
