145069-56-3 Usage
Description
4-[(2,4-Dimethoxyphenyl)(Fmoc-amino)methyl]phenoxyacetic acid is a complex organic compound with a unique chemical structure that features a phenoxyacetic acid backbone, a dimethoxyphenyl group, and an Fmoc-amino-methyl moiety. This molecule is characterized by its potential applications in various fields due to its structural properties and interactions with other molecules.
Uses
Used in Pharmaceutical Industry:
4-[(2,4-Dimethoxyphenyl)(Fmoc-amino)methyl]phenoxyacetic acid is used as a selective aldose reductase inhibitor for its potential antidiabetic properties. The compound's ability to inhibit aldose reductase, an enzyme involved in the polyol pathway, makes it a promising candidate for the development of new antidiabetic drugs.
Used in Chemical Synthesis:
In the field of chemical synthesis, 4-[(2,4-Dimethoxyphenyl)(Fmoc-amino)methyl]phenoxyacetic acid can be utilized as a building block or intermediate for the synthesis of more complex molecules with specific biological activities. Its unique structure allows for further functionalization and modification to create novel compounds with tailored properties.
Used in Research and Development:
4-[(2,4-Dimethoxyphenyl)(Fmoc-amino)methyl]phenoxyacetic acid is also valuable in research and development settings, where it can be employed to study the interactions between various biomolecules and to develop a better understanding of biological processes. Its structural features make it an interesting subject for exploring new mechanisms of action and potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 145069-56-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,4,5,0,6 and 9 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 145069-56:
(8*1)+(7*4)+(6*5)+(5*0)+(4*6)+(3*9)+(2*5)+(1*6)=133
133 % 10 = 3
So 145069-56-3 is a valid CAS Registry Number.
InChI:InChI=1/C32H29NO7/c1-37-22-15-16-27(29(17-22)38-2)31(20-11-13-21(14-12-20)39-19-30(34)35)33-32(36)40-18-28-25-9-5-3-7-23(25)24-8-4-6-10-26(24)28/h3-17,28,31H,18-19H2,1-2H3,(H,33,36)(H,34,35)