1406-65-1 Usage
Description
Chlorophyll is a chlorin pigment found in cyanobacteria and the chloroplasts of algae and plants. It is a magnesium-containing porphyrin that plays a critical role in photosynthesis, allowing plants to convert light energy into chemical energy. Chlorophyll a is the principal form used in oxygenic photosynthesis, absorbing most energy from wavelengths of violet-blue and orange-red light. Chlorophyll b is also involved in photosynthesis and absorbs primarily blue light. There are other forms of chlorophyll, such as chlorophyll c1, c2, c3, which are accessory pigments. Chlorophyll f was recently discovered in cyanobacteria and other oxygenic microorganisms that form stromatolites.
Uses
1. Used in Food Industry:
Chlorophyll is used as a natural coloring agent for various food products, such as sausage casings, oleomargarine, and shortening. It is credited with skin-soothing and healing properties due to its phytol content and has a mild deodorizing effect.
2. Used in Cosmetics and Personal Care:
Chlorophyll is used in the cosmetics and personal care industry for its skin-soothing and healing properties, as well as for its deodorizing effect.
3. Used in Agricultural Applications:
Chlorophyll serves as an indicator of the nitrogen status of plants. A hand-held chlorophyll meter can provide an indication of the leaf nitrogen status of a crop, which is essential for optimizing plant growth and health. Chlorophyll molecules have three functions in plants: they serve as an antenna to absorb light quanta, transmit this energy through resonance transfer, and undergo chemical oxidation in association with enzymes. This process converts the energy of light quanta into chemical energy, which can then be used for various biochemical processes.
4. Used in Research and Education:
Chlorophyll is an essential molecule for studying photosynthesis and the role of different pigments in the process. It is used in research and educational settings to understand the complex interactions between light, pigments, and enzymes in plants and other photosynthetic organisms.
Check Digit Verification of cas no
The CAS Registry Mumber 1406-65-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,4,0 and 6 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1406-65:
(6*1)+(5*4)+(4*0)+(3*6)+(2*6)+(1*5)=61
61 % 10 = 1
So 1406-65-1 is a valid CAS Registry Number.
InChI:InChI=1/C55H73N4O5.Mg/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42;/h13,26,28-33,37,41,51H,1,14-25,27H2,2-12H3,(H-,56,57,58,59,61);/q-1;+2/p-1/b34-26-;/t32-,33-,37+,41+,51-;/m1./s1