135086-76-9 Usage
Description
4-AMINO-3,5-DIFLUORO-PHENOL is an organic compound characterized by the presence of an amino group (-NH2) at the 4th position, and two fluorine atoms at the 3rd and 5th positions of the phenol molecule. It is a building block for the synthesis of various chemical compounds and has potential applications in different industries.
Uses
Used in Pharmaceutical Industry:
4-AMINO-3,5-DIFLUORO-PHENOL is used as an intermediate for the preparation of various pharmaceutical compounds, such as 1-(Adamantan-1-ylcarbonyl)-3-(2,6-difluoro-4-hydroxyphenyl)thiourea and other aniline derivatives. These compounds have potential applications in the development of new drugs and therapeutic agents.
Used in Chemical Synthesis:
4-AMINO-3,5-DIFLUORO-PHENOL is used as a key building block in the synthesis of a wide range of chemical compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure allows for further functionalization and modification, making it a versatile starting material for the development of new molecules with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 135086-76-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,5,0,8 and 6 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 135086-76:
(8*1)+(7*3)+(6*5)+(5*0)+(4*8)+(3*6)+(2*7)+(1*6)=129
129 % 10 = 9
So 135086-76-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H5F2NO/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H,9H2
