129578-07-0 Usage
Description
Goniopypyrone is a naturally occurring compound with potent cytotoxic properties, derived from various plant sources. It exhibits strong bioactivity and has been identified for its potential applications in the pharmaceutical and medical industries due to its ability to target specific cancer cells.
Uses
Used in Anticancer Applications:
Goniopypyrone is used as a cytotoxic agent for its significant cytotoxicity against 3PS murine lymphocytic leukemia cells. This property makes it a promising candidate for the development of novel anticancer therapies, particularly for leukemia and potentially other cancer types. Its ability to target cancer cells selectively may lead to the development of more effective and less toxic treatments in oncology.
Used in Pharmaceutical Research:
Goniopypyrone is used as a key compound in pharmaceutical research for the development of new drugs and therapies. Its potent cytotoxic effects and natural origin make it an attractive candidate for further investigation into its mechanisms of action and potential applications in treating various diseases, including cancer.
Check Digit Verification of cas no
The CAS Registry Mumber 129578-07-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,9,5,7 and 8 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 129578-07:
(8*1)+(7*2)+(6*9)+(5*5)+(4*7)+(3*8)+(2*0)+(1*7)=160
160 % 10 = 0
So 129578-07-0 is a valid CAS Registry Number.
InChI:InChI=1/C13H14O5/c14-9-6-8-10(15)13(18-9)11(16)12(17-8)7-4-2-1-3-5-7/h1-5,8,10-13,15-16H,6H2/t8-,10?,11+,12-,13+/m0/s1
