128446-34-4 Usage
Description
3-FLUORO-4-NITROTOLUENE is an organic compound with the molecular formula C7H6FNO2. It is a derivative of toluene, featuring a fluorine atom at the 3rd position and a nitro group (-NO2) at the 4th position. 3-FLUORO-4-NITROTOLUENE is typically a white powder and is used in various applications across different industries.
Uses
Used in Research and Development (R&D):
3-FLUORO-4-NITROTOLUENE is used as a chemical intermediate for the synthesis of various pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure allows for further functionalization and modification, making it a valuable compound in the development of new molecules with specific properties and applications.
Used in Pharmaceutical Industry:
3-FLUORO-4-NITROTOLUENE is used as a building block for the development of new drugs, particularly those targeting specific biological pathways or receptors. Its presence in a molecule can influence the drug's pharmacokinetics, pharmacodynamics, and overall efficacy.
Used in Agrochemical Industry:
In the agrochemical industry, 3-FLUORO-4-NITROTOLUENE is used as a starting material for the synthesis of novel pesticides, herbicides, and insecticides. The introduction of a fluorine atom and a nitro group can enhance the biological activity and selectivity of the final product, leading to more effective and targeted pest control solutions.
Used in Chemical Synthesis:
3-FLUORO-4-NITROTOLUENE is also used as a reagent in various chemical synthesis processes, including the production of dyes, polymers, and other specialty chemicals. Its unique properties can be exploited to create new materials with improved performance characteristics.
Used in Material Science:
3-FLUORO-4-NITROTOLUENE can be utilized in the development of new materials with specific properties, such as enhanced thermal stability, chemical resistance, or electronic properties. Its incorporation into polymers or other materials can lead to novel applications in various industries, including electronics, automotive, and aerospace.
Check Digit Verification of cas no
The CAS Registry Mumber 128446-34-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,2,8,4,4 and 6 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 128446-34:
(8*1)+(7*2)+(6*8)+(5*4)+(4*4)+(3*6)+(2*3)+(1*4)=134
134 % 10 = 4
So 128446-34-4 is a valid CAS Registry Number.
InChI:InChI:1S/C63H110O45/c1-19(67)9-88-14-27-51-38(78)46(86)62(99-27)108-55-31(18-92-13-23(5)71)100-63(47(87)39(55)79)107-54-30(17-91-12-22(4)70)97-60(44(84)36(54)76)103-50-26(8-66)95-58(42(82)34(50)74)105-52-28(15-89-10-20(2)68)98-61(45(85)37(52)77)106-53-29(16-90-11-21(3)69)96-59(43(83)35(53)75)102-49-25(7-65)93-56(40(80)32(49)72)101-48-24(6-64)94-57(104-51)41(81)33(48)73/h19-87H,6-18H2,1-5H3