113119-46-3 Usage
Description
Bis(2,4,6-trimethylpyridine)iodine(I) hexafluorophosphate, also known as Bis(2,4,6-trimethylpyridine)iodonium Hexafluorophosphate (CAS# 113119-46-3), is a pale yellow to beige crystalline powder. It is a significant compound in the field of chemistry, particularly as a building block and iodinating reagent. Its unique structure and properties make it a valuable component in various chemical reactions and processes.
Uses
Used in Chemical Synthesis:
Bis(2,4,6-trimethylpyridine)iodine(I) hexafluorophosphate is used as a building block in chemical synthesis for its ability to facilitate the formation of complex molecular structures. Its unique properties allow it to be a key component in the creation of various compounds, contributing to the advancement of chemical research and development.
Used in Enantioselective Halogenative Semi-pinacol Rearrangement:
In the field of organic chemistry, Bis(2,4,6-trimethylpyridine)iodine(I) hexafluorophosphate is used as an iodinating reagent for enantioselective halogenative semi-pinacol rearrangement. This application is crucial for the synthesis of chiral molecules, which are essential in the pharmaceutical industry for the development of drugs with specific biological activities.
Used in Pharmaceutical Industry:
Bis(2,4,6-trimethylpyridine)iodine(I) hexafluorophosphate is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique properties enable the development of new drugs with improved efficacy and selectivity, contributing to the advancement of medical treatments and therapies.
Used in Research and Development:
In the research and development sector, Bis(2,4,6-trimethylpyridine)iodine(I) hexafluorophosphate is used as a valuable tool for studying various chemical reactions and processes. Its unique properties and reactivity make it an essential compound for understanding the underlying mechanisms of complex chemical transformations, leading to the discovery of new synthetic routes and methodologies.
Check Digit Verification of cas no
The CAS Registry Mumber 113119-46-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,1,3,1,1 and 9 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 113119-46:
(8*1)+(7*1)+(6*3)+(5*1)+(4*1)+(3*9)+(2*4)+(1*6)=83
83 % 10 = 3
So 113119-46-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H22IN2/c1-11-7-13(3)18(14(4)8-11)17-19-15(5)9-12(2)10-16(19)6/h7-10H,1-6H3/q+1
