109537-55-5 Usage
Description
3-(FURFURYLDITHIO)-2-METHYLFURAN is a colorless liquid with a strong, sulfurous aroma. It has high strength odor and is recommended to be smelled in a 0.1% solution or less.
Uses
Used in Fragrance Industry:
3-(FURFURYLDITHIO)-2-METHYLFURAN is used as a fragrance ingredient for its strong, sulfurous aroma. It can be used to add a unique and distinct scent to various fragrance products.
Used in Chemical Synthesis:
3-(FURFURYLDITHIO)-2-METHYLFURAN can be used as a chemical intermediate in the synthesis of various compounds. Its unique chemical structure allows it to be a valuable building block in the creation of new molecules.
Used in Research and Development:
Due to its unique chemical properties, 3-(FURFURYLDITHIO)-2-METHYLFURAN can be used in research and development for studying its potential applications in various fields, such as pharmaceuticals, materials science, and environmental science.
Check Digit Verification of cas no
The CAS Registry Mumber 109537-55-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,9,5,3 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 109537-55:
(8*1)+(7*0)+(6*9)+(5*5)+(4*3)+(3*7)+(2*5)+(1*5)=135
135 % 10 = 5
So 109537-55-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H10O2S2/c1-8-10(4-6-11-8)14-13-7-9-3-2-5-12-9/h2-6H,7H2,1H3
