10406-06-1 Usage
Description
5-BROMO-1H-INDOLE-3-CARBOXYLIC ACID is an organic compound that serves as a crucial intermediate in the synthesis of various indole derivatives. It is characterized by the presence of a bromine atom at the 5-position and a carboxylic acid group at the 3-position of the indole ring. 5-BROMO-1H-INDOLE-3-CARBOXYLIC ACID is known for its potential applications in the pharmaceutical and chemical industries due to its unique structural properties.
Uses
Used in Pharmaceutical Industry:
5-BROMO-1H-INDOLE-3-CARBOXYLIC ACID is used as a key intermediate for the synthesis of indole derivatives that act as inhibitors for the vascular endothelial growth factor receptor 2 (VEGFR-2) tyrosine kinase. These inhibitors play a significant role in the development of novel therapeutic agents targeting various diseases, including cancer, by disrupting the angiogenesis process.
Used in Chemical Synthesis:
In the chemical synthesis industry, 5-BROMO-1H-INDOLE-3-CARBOXYLIC ACID is utilized as a building block for the creation of a wide range of indole-based compounds. These compounds find applications in various fields, such as pharmaceuticals, agrochemicals, and materials science, due to their diverse biological activities and unique chemical properties.
Check Digit Verification of cas no
The CAS Registry Mumber 10406-06-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,0 and 6 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 10406-06:
(7*1)+(6*0)+(5*4)+(4*0)+(3*6)+(2*0)+(1*6)=51
51 % 10 = 1
So 10406-06-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H6BrNO2/c10-5-1-2-8-6(3-5)7(4-11-8)9(12)13/h1-4,11H,(H,12,13)