10402-90-1 Usage
Description
Eprazinone, also known as a piperazine derivative, is a chemical compound belonging to the class of piperazines. It is characterized by the replacement of the two amino hydrogens of piperazine with 2-benzoylpropyl and 2-ethoxy-2-phenylethyl groups. This unique structure endows Eprazinone with specific properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Eprazinone is used as a pharmaceutical compound for its potential therapeutic effects. Its unique structure allows it to interact with specific biological targets, making it a candidate for the development of new drugs. The compound may be utilized in the treatment of various medical conditions, such as neurological disorders or other diseases where its specific interactions can be beneficial.
Used in Chemical Research:
In the field of chemical research, Eprazinone serves as a valuable compound for studying the properties and behavior of piperazine derivatives. Its unique structure can provide insights into the design and synthesis of new molecules with similar or improved characteristics. Researchers can use Eprazinone as a starting point for developing novel chemical entities with potential applications in various industries.
Used in Material Science:
Eprazinone's unique structure may also find applications in material science, where its properties can be harnessed to create new materials with specific characteristics. For instance, its interaction with other molecules could be exploited to develop materials with enhanced mechanical, electrical, or thermal properties, depending on the desired application.
Therapeutic Function
Antitussive
Check Digit Verification of cas no
The CAS Registry Mumber 10402-90-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,4,0 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 10402-90:
(7*1)+(6*0)+(5*4)+(4*0)+(3*2)+(2*9)+(1*0)=51
51 % 10 = 1
So 10402-90-1 is a valid CAS Registry Number.
InChI:InChI=1/C24H32N2O2/c1-4-23-18-25(17-19(2)24(27)22-13-9-6-10-14-22)15-16-26(23)28-20(3)21-11-7-5-8-12-21/h5-14,19-20,23H,4,15-18H2,1-3H3