10351-19-6 Usage
Description
(4-Pyridylthio)acetic acid, with the chemical formula C7H7NO2S, is an organic compound characterized by an off-white crystalline powder appearance. It is known for its unique chemical properties and is utilized in various organic synthesis processes.
Uses
Used in Organic Synthesis:
(4-Pyridylthio)acetic acid is used as a synthetic intermediate for the development of various organic compounds. Its presence in the synthesis process allows for the creation of a wide range of chemical entities, making it a valuable component in the field of organic chemistry.
Used in Pharmaceutical Industry:
(4-Pyridylthio)acetic acid is used as a building block in the synthesis of pharmaceutical compounds. Its unique structure and reactivity contribute to the development of new drugs with potential therapeutic applications.
Used in Chemical Research:
(4-Pyridylthio)acetic acid is employed as a research tool in chemical laboratories. It aids scientists in understanding the fundamental principles of organic reactions and contributes to the advancement of chemical knowledge.
Used in Material Science:
(4-Pyridylthio)acetic acid is utilized in the development of new materials with specific properties. Its integration into material compositions can lead to the creation of innovative products with applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 10351-19-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,3,5 and 1 respectively; the second part has 2 digits, 1 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 10351-19:
(7*1)+(6*0)+(5*3)+(4*5)+(3*1)+(2*1)+(1*9)=56
56 % 10 = 6
So 10351-19-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H7NO2S/c9-7(10)5-11-6-1-3-8-4-2-6/h1-4H,5H2,(H,9,10)/p-1
