10139-04-5 Usage
Description
PHENYL 2-ACETAMIDO-2-DEOXY-ALPHA-D-GALACTOPYRANOSIDE, also known as N-acetyl-alpha-D-glucosaminide, is a chemical compound with a phenyl group as the anomeric substituent. It is characterized by its white to off-white powder or crystal appearance and is derived from the acetamido group and deoxy sugar of alpha-D-galactose.
Uses
Used in Pharmaceutical Industry:
PHENYL 2-ACETAMIDO-2-DEOXY-ALPHA-D-GALACTOPYRANOSIDE is used as a pharmaceutical compound for its potential therapeutic applications. Its unique structure allows it to interact with various biological targets, making it a promising candidate for the development of new drugs.
Used in Chemical Research:
In the field of chemical research, PHENYL 2-ACETAMIDO-2-DEOXY-ALPHA-D-GALACTOPYRANOSIDE serves as a valuable compound for studying the properties and interactions of N-acetyl-alpha-D-glucosaminides. Its chemical properties and structure can provide insights into the development of new materials and applications in various industries.
Used in Material Science:
PHENYL 2-ACETAMIDO-2-DEOXY-ALPHA-D-GALACTOPYRANOSIDE can be utilized in material science as a component in the development of novel materials with specific properties. Its unique chemical structure may contribute to the creation of advanced materials with applications in various fields, such as electronics, energy, and environmental protection.
Check Digit Verification of cas no
The CAS Registry Mumber 10139-04-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,0,1,3 and 9 respectively; the second part has 2 digits, 0 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 10139-04:
(7*1)+(6*0)+(5*1)+(4*3)+(3*9)+(2*0)+(1*4)=55
55 % 10 = 5
So 10139-04-5 is a valid CAS Registry Number.
InChI:InChI=1/C14H19NO6/c1-8(17)15-11-13(19)12(18)10(7-16)21-14(11)20-9-5-3-2-4-6-9/h2-6,10-14,16,18-19H,7H2,1H3,(H,15,17)/t10-,11-,12-,13-,14+/m1/s1
10139-04-5Relevant articles and documents
Synthesis of N-Acetylmuramyl-L-Alanyld- Isoglutamine α-Phenylglycoside
Zemlyakov,Tsikalova,Tsikalov
, (2020)
N-Acetylmuramyl-L-alanyl-D-isoglutamine α-phenylglycoside was synthesized from α-phenyl-D-glucosaminide peracetate, which was obtained by fusing β-D-glucosamine pentaacetate with phenol and zinc chloride followed by deacetylation. α-Phenyl-N-acetylglucosa