101084-81-5 Usage
Description
3-Carboxy-5-nitrophenylboronic acid is an organic compound with the molecular formula C6H6BNO6. It is a white solid that is commonly used as a reactant in various chemical reactions and processes due to its unique chemical properties.
Uses
1. Reactant for Copper-catalyzed Chlorination:
3-Carboxy-5-nitrophenylboronic acid is used as a reactant in the copper-catalyzed chlorination process. This reaction is significant in the synthesis of various organic compounds, particularly those with chlorinated functional groups.
2. Parallel Solid-phase Synthesis:
In the field of pharmaceutical chemistry, 3-Carboxy-5-nitrophenylboronic acid is used as a reactant for the parallel solid-phase synthesis of azabicyclooctylidenemethylbenzamides. These compounds are known as μand δ-opioid agonists, which have potential applications in the development of pain relief medications.
3. Immobilization of Enzymes:
3-Carboxy-5-nitrophenylboronic acid is used as a reactant for the immobilization of glucose oxidase and acetylcholinesterase on boronic acid-activated silica surfaces. This immobilization technique is crucial in the development of biosensors and biocatalytic systems, as it allows for the stable attachment of enzymes to solid supports, enhancing their stability and reusability.
4. Suzuki Reaction:
In the field of organic synthesis, 3-Carboxy-5-nitrophenylboronic acid is used as a reactant in the Suzuki reaction. This cross-coupling reaction is widely employed for the formation of carbon-carbon bonds, particularly in the synthesis of complex organic molecules and pharmaceutical compounds.
Used in Chemical Synthesis Industry:
3-Carboxy-5-nitrophenylboronic acid is used as a key reactant for the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique reactivity and functional groups make it a valuable building block in the development of new molecules with diverse applications.
Used in Biotechnology Industry:
3-Carboxy-5-nitrophenylboronic acid is used as a reactant for the immobilization of enzymes and the development of biosensors. This application is crucial in the biotechnology industry, as it enables the creation of more efficient and stable biocatalytic systems for various industrial and medical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 101084-81-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,0,1,0,8 and 4 respectively; the second part has 2 digits, 8 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 101084-81:
(8*1)+(7*0)+(6*1)+(5*0)+(4*8)+(3*4)+(2*8)+(1*1)=75
75 % 10 = 5
So 101084-81-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H6BNO6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3,12-13H,(H,10,11)
101084-81-5Relevant articles and documents
Indole and quinoline derivatives and its preparation method and application
-
Paragraph 0190, (2017/02/28)
The invention provides an indoloquinoline derivative, a preparation method and application thereof in preparing antitumor drugs and antiviral drugs. The chemical structure of the indoloquinoline derivative is shown as a formula I. Experiments show that a partly-boric-acid-modified indoloquinoline derivative and a non-boric-acid-modified indoloquinoline derivative have strong inhibition effect on various tumor cell strains, thereby being capable of being used for preparation of the antitumor drugs, and have strong antiviral activity, thereby being capable of being used for preparation of the antiviral drugs.
