The Pyridine,2,6-difluoro-3-iodo-, with the CAS registry number 685517-67-3, is also known as ZINC16159557. This chemical's molecular formula is C₅H₂F₂IN and molecular weight is 240.9773564. Its IUPAC name is called 2,6-difluoro-3-iodopyridine.

Physical properties of Pyridine,2,6-difluoro-3-iodo-: (1)ACD/LogP: 1.90; (2)ACD/LogD (pH 5.5): 1.9; (3)ACD/LogD (pH 7.4): 1.9; (4)ACD/BCF (pH 5.5): 16.39; (5)ACD/BCF (pH 7.4): 16.39; (6)ACD/KOC (pH 5.5): 257.65; (7)ACD/KOC (pH 7.4): 257.65; (8)#H bond acceptors: 1; (9)Index of Refraction: 1.572; (10)Molar Refractivity: 37.23 cm³; (11)Molar Volume: 113.1 cm³; (12)Surface Tension: 43.9 dyne/cm; (13)Density: 2.129 g/cm³; (14)Flash Point: 92.9 °C; (15)Enthalpy of Vaporization: 44.77 kJ/mol; (16)Boiling Point: 230.1 °C at 760 mmHg; (17)Vapour Pressure: 0.102 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=CC(=NC(=C1I)F)F
(2)InChI: InChI=1S/C5H2F2IN/c6-4-2-1-3(8)5(7)9-4/h1-2H
(3)InChIKey: UTWLONSABCGCBR-UHFFFAOYSA-N