The Benzonitrile,4-hydroxy-2-methyl- is an organic compound with the molecular formula C₈H₇NO. Its CAS registry number is 14143-26-1. The IUPAC name of this chemical is called 4-Hydroxy-2-methylbenzonitrile. What's more, the molecular weight of this chemical is 133.1473.

Physical properties about Benzonitrile,4-hydroxy-2-methyl- are: (1)ACD/LogP: 2.06; (2)#of Rule of 5 Violations: 0; (3)#H bond acceptors: 2; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 1; (6)Polar Surface Area: 33.02 Å²; (7)Index of Refraction: 1.575; (8)Molar Refractivity: 37.47 cm³; (9)Molar Volume: 113.3 cm³; (10)Polarizability: 14.85×10^-24 cm³; (11)Surface Tension: 53.4 dyne/cm; (12)Density: 1.17 g/cm³; (13)Flash Point: 133.7 °C; (14)Enthalpy of Vaporization: 55.87 kJ/mol; (15)Boiling Point: 297.4 °C at 760 mmHg; (16)Vapour Pressure: 0.000764 mmHg at 25 °C.

You can still convert the following datas into molecular structure:
(1) SMILES: N#Cc1c(cc(O)cc1)C
(2) InChI: InChI=1/C8H7NO/c1-6-4-8(10)3-2-7(6)5-9/h2-4,10H,1H3
(3) InChIKey: PNQUZYVEQUGPPO-UHFFFAOYAL