The 7,10-Dichloro-2-methoxybenzo[b]-1,5-naphthyridine with the CAS number 6626-40-0 is also called Benzo[b]-1,5-naphthyridine,7,10-dichloro-2-methoxy-. Its EINECS registry number is 229-588-9. The molecular formula is C₁₃H₈Cl₂N₂O.

The properties of the chemical are: (1)ACD/LogP: 2.72; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 2.72; (4)ACD/LogD (pH 7.4): 2.72; (5)ACD/BCF (pH 5.5): 68.34; (6)ACD/BCF (pH 7.4): 68.36; (7)ACD/KOC (pH 5.5): 715.84; (8)ACD/KOC (pH 7.4): 716.05; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 35.01 Å²; (13)Index of Refraction: 1.704; (14)Molar Refractivity: 74.58 cm³; (15)Molar Volume: 192 cm³; (16)Polarizability: 29.56×10^-24cm³; (17)Surface Tension: 58.7; (18)Enthalpy of Vaporization: 66.34 kJ/mol; (19)Vapour Pressure: 2.48×10^-7 mmHg at 25°C.

Uses: This chemical can react with phenol to product 7-chloro-2-methoxy-10-phenoxy-benzo[b][1,5]naphthyridine. This reaction needs reagent NaOH at temperature of 120 - 130 °C. The yield is 83%. This reaction is Substitution.

You can still convert the following datas into molecular structure:
(1)SMILES: Clc2c3nc(OC)ccc3nc1cc(Cl)ccc12
(2)InChI: InChI=1/C13H8Cl2N2O/c1-18-11-5-4-9-13(17-11)12(15)8-3-2-7(14)6-10(8)16-9/h2-6H,1H3
(3)InChIKey: KHPZCNJKNIHKPI-UHFFFAOYAP

The toxicity data is as follows: