The CAS register number of 5-Chloro-2-fluoropyridine-3-boronic acid is 937595-70-5. It also can be called as Boronic acid,B-(5-chloro-2-fluoro-3-pyridinyl)- and the systematic name about this chemical is (5-chloro-2-fluoro-3-pyridyl)boronic acid. It belongs to the following product categories, such as blocks, BoronicAcids, Pyridines and so on.

Physical properties about 5-Chloro-2-fluoropyridine-3-boronic acid are: (1)ACD/LogP: 1.00; (2)ACD/LogD (pH 5.5): 0.79; (3)#H bond acceptors: 3; (4)#H bond donors: 2; (5)#Freely Rotating Bonds: 3; (6)Polar Surface Area: 53.35Ų; (7)Index of Refraction: 1.533; (8)Molar Refractivity: 36.02 cm³; (9)Molar Volume: 116 cm³; (10)Polarizability: 14.28x10^-24cm³; (11)Surface Tension: 52.1 dyne/cm; (12)Enthalpy of Vaporization: 62.35 kJ/mol; (13)Boiling Point: 346.6 °C at 760 mmHg; (14)Vapour Pressure: 2.15E-05 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: OB(O)c1cc(Cl)cnc1F
(2)InChI: InChI=1/C5H4BClFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
(3)InChIKey: ZUDXVHDVUTUTFH-UHFFFAOYAG
(4)Std. InChI: InChI=1S/C5H4BClFNO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2,10-11H
(5)Std. InChIKey: ZUDXVHDVUTUTFH-UHFFFAOYSA-N