The 4-Pyrimidinamine,2-chloro-5-nitro-, with the CAS registry number 1920-66-7, is also known as 4-Amino-2-chloro-5-nitropyrimidine. It belongs to the product category of Pharmacetical. Its EINECS registry number is 217-648-7. This chemical's molecular formula is C₄H₃ClN₄O₂ and molecular weight is 174.55. Its IUPAC name is called 2-chloro-5-nitropyrimidin-4-amine.

Physical properties of 4-Pyrimidinamine,2-chloro-5-nitro-: (1)ACD/LogP: -0.03; (2)ACD/LogD (pH 5.5): -0.03; (3)ACD/LogD (pH 7.4): -0.03; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 1; (6)ACD/KOC (pH 5.5): 22.99; (7)ACD/KOC (pH 7.4): 22.99; (8)#H bond acceptors: 6; (9)#H bond donors: 2; (10)#Freely Rotating Bonds: 1; (11)Index of Refraction: 1.67; (12)Molar Refractivity: 38.11 cm³; (13)Molar Volume: 101.9 cm³; (14)Surface Tension: 88.5 dyne/cm; (15)Density: 1.712 g/cm³; (16)Flash Point: 223.5 °C; (17)Enthalpy of Vaporization: 70.4 kJ/mol; (18)Boiling Point: 446 °C at 760 mmHg; (19)Vapour Pressure: 3.79E-08 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)Canonical SMILES: C1=C(C(=NC(=N1)Cl)N)[N+](=O)[O-]
(2)InChI: InChI=1S/C4H3ClN4O2/c5-4-7-1-2(9(10)11)3(6)8-4/h1H,(H2,6,7,8)
(3)InChIKey: RZGOEIWDMVQJBQ-UHFFFAOYSA-N